C17H24N2O5 — CID 174753126
1-O-amino 3-O-benzyl 3-(1-hydroxypropan-2-yl)piperidine-1,3-dicarboxylate (PubChem CID 174753126) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-O-amino 3-O-benzyl 3-(1-hydroxypropan-2-yl)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-amino 3-O-benzyl 3-(1-hydroxypropan-2-yl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174753126 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-O-amino 3-O-benzyl 3-(1-hydroxypropan-2-yl)piperidine-1,3-dicarboxylate |
| SMILES | CC(CO)C1(C(=O)OCc2ccccc2)CCCN(C(=O)ON)C1 |
| InChI | InChI=1S/C17H24N2O5/c1-13(10-20)17(8-5-9-19(12-17)16(22)24-18)15(21)23-11-14-6-3-2-4-7-14/h2-4,6-7,13,20H,5,8-12,18H2,1H3 |
| InChIKey | IOETWCHUTINUEE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|