C12H19NO2 — CID 174755291
3-[2-(dimethylamino)ethyl]-2-prop-2-enylpenta-2,4-dienoic acid (PubChem CID 174755291) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-2-prop-2-enylpenta-2,4-dienoic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl]-2-prop-2-enylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 174755291 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-2-prop-2-enylpenta-2,4-dienoic acid |
| SMILES | C=CCC(C(=O)O)=C(C=C)CCN(C)C |
| InChI | InChI=1S/C12H19NO2/c1-5-7-11(12(14)15)10(6-2)8-9-13(3)4/h5-6H,1-2,7-9H2,3-4H3,(H,14,15) |
| InChIKey | OKXSGWCEKWFLLI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|