About chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid
chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid (PubChem CID 87075908) has the molecular formula C11H19ClN2O3
and a molecular weight of 262.74 g/mol. Its IUPAC name is chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid.
Molecular Properties
| Compound Name | chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid |
| PubChem CID | 87075908 |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid |
| SMILES | C=CC(=O)NC=C(CCN(C)C)C(=O)O.CCl |
| InChI | InChI=1S/C10H16N2O3.CH3Cl/c1-4-9(13)11-7-8(10(14)15)5-6-12(2)3;1-2/h4,7H,1,5-6H2,2-3H3,(H,11,13)(H,14,15);1H3 |
| InChIKey | HHCCLDDVLKSEMJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid?
The IUPAC name of chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid (CID 87075908) is chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid.
What is the SMILES notation for chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid?
The canonical SMILES for chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid is C=CC(=O)NC=C(CCN(C)C)C(=O)O.CCl.
What is the InChIKey of chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid?
The InChIKey is HHCCLDDVLKSEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3.CH3Cl/c1-4-9(13)11-7-8(10(14)15)5-6-12(2)3;1-2/h4,7H,1,5-6H2,2-3H3,(H,11,13)(H,14,15);1H3.
What are the key properties of chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid?
chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid has a molecular weight of 262.74 g/mol, XLogP of 1.06, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;4-(dimethylamino)-2-[(prop-2-enoylamino)methylidene]butanoic acid is sourced from PubChem (CID 87075908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).