C4H8N3O2S- — CID 174758838
4-(sulfinatoamino)-2,3-dihydro-1H-pyrazine (PubChem CID 174758838) has the molecular formula C4H8N3O2S- and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-(sulfinatoamino)-2,3-dihydro-1H-pyrazine.
| Compound Name | 4-(sulfinatoamino)-2,3-dihydro-1H-pyrazine |
|---|---|
| PubChem CID | 174758838 |
| Molecular Formula | C4H8N3O2S- |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 4-(sulfinatoamino)-2,3-dihydro-1H-pyrazine |
| SMILES | O=S([O-])NN1C=CNCC1 |
| InChI | InChI=1S/C4H9N3O2S/c8-10(9)6-7-3-1-5-2-4-7/h1,3,5-6H,2,4H2,(H,8,9)/p-1 |
| InChIKey | DGNCOUXXVCGHHY-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|