About CID 18914755
CID 18914755 (PubChem CID 18914755) has the molecular formula H2NO2S2-
and a molecular weight of 112.15 g/mol.
Molecular Properties
| Compound Name | CID 18914755 |
| PubChem CID | 18914755 |
| Molecular Formula | H2NO2S2- |
| Molecular Weight | 112.15 g/mol |
| Exact Mass | 111.95 |
| IUPAC Name | — |
| SMILES | O=S([O-])NS |
| InChI | InChI=1S/H3NO2S2/c2-5(3)1-4/h1,4H,(H,2,3)/p-1 |
| InChIKey | HJUHSKUTGBSYNM-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 18914755 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18914755?
The IUPAC name of CID 18914755 (CID 18914755) is not available.
What is the SMILES notation for CID 18914755?
The canonical SMILES for CID 18914755 is O=S([O-])NS.
What is the InChIKey of CID 18914755?
The InChIKey is HJUHSKUTGBSYNM-UHFFFAOYSA-M. The full InChI is InChI=1S/H3NO2S2/c2-5(3)1-4/h1,4H,(H,2,3)/p-1.
What are the key properties of CID 18914755?
CID 18914755 has a molecular weight of 112.15 g/mol, XLogP of -0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18914755 is sourced from PubChem (CID 18914755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).