About sodium;dioxovanadium;fluoro(hydroxy)phosphinate
sodium;dioxovanadium;fluoro(hydroxy)phosphinate (PubChem CID 174759223) has the molecular formula HFNaO5PV
and a molecular weight of 204.91 g/mol. Its IUPAC name is sodium;dioxovanadium;fluoro(hydroxy)phosphinate.
Molecular Properties
| Compound Name | sodium;dioxovanadium;fluoro(hydroxy)phosphinate |
| PubChem CID | 174759223 |
| Molecular Formula | HFNaO5PV |
| Molecular Weight | 204.91 g/mol |
| Exact Mass | 204.89 |
| IUPAC Name | sodium;dioxovanadium;fluoro(hydroxy)phosphinate |
| SMILES | O=P([O-])(O)F.O=[V]=O.[Na+] |
| InChI | InChI=1S/FH2O3P.Na.2O.V/c1-5(2,3)4;;;;/h(H2,2,3,4);;;;/q;+1;;;/p-1 |
| InChIKey | YJTWWMBAQIMCST-UHFFFAOYSA-M |
| XLogP | -3.82 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.91 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;dioxovanadium;fluoro(hydroxy)phosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dioxovanadium;fluoro(hydroxy)phosphinate?
The IUPAC name of sodium;dioxovanadium;fluoro(hydroxy)phosphinate (CID 174759223) is sodium;dioxovanadium;fluoro(hydroxy)phosphinate.
What is the SMILES notation for sodium;dioxovanadium;fluoro(hydroxy)phosphinate?
The canonical SMILES for sodium;dioxovanadium;fluoro(hydroxy)phosphinate is O=P([O-])(O)F.O=[V]=O.[Na+].
What is the InChIKey of sodium;dioxovanadium;fluoro(hydroxy)phosphinate?
The InChIKey is YJTWWMBAQIMCST-UHFFFAOYSA-M. The full InChI is InChI=1S/FH2O3P.Na.2O.V/c1-5(2,3)4;;;;/h(H2,2,3,4);;;;/q;+1;;;/p-1.
What are the key properties of sodium;dioxovanadium;fluoro(hydroxy)phosphinate?
sodium;dioxovanadium;fluoro(hydroxy)phosphinate has a molecular weight of 204.91 g/mol, XLogP of -3.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dioxovanadium;fluoro(hydroxy)phosphinate is sourced from PubChem (CID 174759223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).