C2H9F4LiO16P4 — CID 175045529
lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid (PubChem CID 175045529) has the molecular formula C2H9F4LiO16P4 and a molecular weight of 495.91 g/mol. Its IUPAC name is lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid.
| Compound Name | lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid |
|---|---|
| PubChem CID | 175045529 |
| Molecular Formula | C2H9F4LiO16P4 |
| Molecular Weight | 495.91 g/mol |
| Exact Mass | 495.89 |
| IUPAC Name | lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P([O-])(O)F.[Li+] |
| InChI | InChI=1S/C2H2O4.4FH2O3P.Li/c3-1(4)2(5)6;4*1-5(2,3)4;/h(H,3,4)(H,5,6);4*(H2,2,3,4);/q;;;;;+1/p-1 |
| InChIKey | OGJQVRIEKWJQLI-UHFFFAOYSA-M |
| XLogP | -4.28 |
| TPSA | 307.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.91 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|