lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid

C2H9F4LiO16P4 — CID 175045529

IUPAClithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid
SMILESO=C(O)C(=O)O.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P([O-])(O)F.[Li+]
InChIInChI=1S/C2H2O4.4FH2O3P.Li/c3-1(4)2(5)6;4*1-5(2,3)4;/h(H,3,4)(H,5,6);4*(H2,2,3,4);/q;;;;;+1/p-1
InChIKeyOGJQVRIEKWJQLI-UHFFFAOYSA-M
MW495.91 g/mol
LogP-4.28
Rot. Bonds

About lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid

lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid (PubChem CID 175045529) has the molecular formula C2H9F4LiO16P4 and a molecular weight of 495.91 g/mol. Its IUPAC name is lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid.

Molecular Properties

Compound Namelithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid
PubChem CID175045529
Molecular FormulaC2H9F4LiO16P4
Molecular Weight495.91 g/mol
Exact Mass495.89
IUPAC Namelithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid
SMILESO=C(O)C(=O)O.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P([O-])(O)F.[Li+]
InChIInChI=1S/C2H2O4.4FH2O3P.Li/c3-1(4)2(5)6;4*1-5(2,3)4;/h(H,3,4)(H,5,6);4*(H2,2,3,4);/q;;;;;+1/p-1
InChIKeyOGJQVRIEKWJQLI-UHFFFAOYSA-M
XLogP-4.28
TPSA307.55 Ų
H-Bond Donors9
H-Bond Acceptors7
Rotatable Bonds
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500495.91
LogP ≤ 5-4.28
H-Bond Donors ≤ 59
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid?
The IUPAC name of lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid (CID 175045529) is lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid.
What is the SMILES notation for lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid?
The canonical SMILES for lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid is O=C(O)C(=O)O.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P([O-])(O)F.[Li+].
What is the InChIKey of lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid?
The InChIKey is OGJQVRIEKWJQLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O4.4FH2O3P.Li/c3-1(4)2(5)6;4*1-5(2,3)4;/h(H,3,4)(H,5,6);4*(H2,2,3,4);/q;;;;;+1/p-1.
What are the key properties of lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid?
lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid has a molecular weight of 495.91 g/mol, XLogP of -4.28, 0 rotatable bonds, 9 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;fluoro(hydroxy)phosphinate;fluorophosphonic acid;oxalic acid is sourced from PubChem (CID 175045529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).