(2,2-dibutylhydrazinyl)phosphonic acid

C8H21N2O3P — CID 174760569

IUPAC(2,2-dibutylhydrazinyl)phosphonic acid
SMILESCCCCN(CCCC)NP(=O)(O)O
InChIInChI=1S/C8H21N2O3P/c1-3-5-7-10(8-6-4-2)9-14(11,12)13/h3-8H2,1-2H3,(H3,9,11,12,13)
InChIKeyOVYWNLOMDVKZJL-UHFFFAOYSA-N
MW224.24 g/mol
LogP1.49
Rot. Bonds8

About (2,2-dibutylhydrazinyl)phosphonic acid

(2,2-dibutylhydrazinyl)phosphonic acid (PubChem CID 174760569) has the molecular formula C8H21N2O3P and a molecular weight of 224.24 g/mol. Its IUPAC name is (2,2-dibutylhydrazinyl)phosphonic acid.

Molecular Properties

Compound Name(2,2-dibutylhydrazinyl)phosphonic acid
PubChem CID174760569
Molecular FormulaC8H21N2O3P
Molecular Weight224.24 g/mol
Exact Mass224.13
IUPAC Name(2,2-dibutylhydrazinyl)phosphonic acid
SMILESCCCCN(CCCC)NP(=O)(O)O
InChIInChI=1S/C8H21N2O3P/c1-3-5-7-10(8-6-4-2)9-14(11,12)13/h3-8H2,1-2H3,(H3,9,11,12,13)
InChIKeyOVYWNLOMDVKZJL-UHFFFAOYSA-N
XLogP1.49
TPSA72.80 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 51.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2,2-dibutylhydrazinyl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

nonakis(N,N-dibutylbutan-1-amine);phosphoric acid
CID 173155970
bis(dibutylamino)phosphinic acid
CID 149434212
tris(N-butyl-N-fluorobutan-1-amine);phosphoric acid
CID 175403911
N,N-dibutylbutan-1-amine;difluorophosphinic acid
CID 130422664
(dibutylamino) dihydrogen phosphate
CID 22117086
butoxy-N,N-dibutylphosphonamidic acid
CID 18676696
dodecane;phosphoric acid
CID 88801558
N,N-dimethylbutan-1-amine;methanesulfonic acid
CID 174158325
[4-(dioctylamino)butylamino]phosphonic acid
CID 58601813
2-[butyl(2-methoxyethyl)amino]ethyl dihydrogen phosphate
CID 58758794
bis(2,2-dibutylhydrazinyl)methylidene-dimethylazanium chloride
CID 158237213
N,N-dimethylheptadecan-1-amine;phosphoric acid;hydrobromide
CID 174790998

Frequently Asked Questions

What is the IUPAC name of (2,2-dibutylhydrazinyl)phosphonic acid?
The IUPAC name of (2,2-dibutylhydrazinyl)phosphonic acid (CID 174760569) is (2,2-dibutylhydrazinyl)phosphonic acid.
What is the SMILES notation for (2,2-dibutylhydrazinyl)phosphonic acid?
The canonical SMILES for (2,2-dibutylhydrazinyl)phosphonic acid is CCCCN(CCCC)NP(=O)(O)O.
What is the InChIKey of (2,2-dibutylhydrazinyl)phosphonic acid?
The InChIKey is OVYWNLOMDVKZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21N2O3P/c1-3-5-7-10(8-6-4-2)9-14(11,12)13/h3-8H2,1-2H3,(H3,9,11,12,13).
What are the key properties of (2,2-dibutylhydrazinyl)phosphonic acid?
(2,2-dibutylhydrazinyl)phosphonic acid has a molecular weight of 224.24 g/mol, XLogP of 1.49, 8 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dibutylhydrazinyl)phosphonic acid is sourced from PubChem (CID 174760569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).