C19H44ClN5 — CID 158237213
bis(2,2-dibutylhydrazinyl)methylidene-dimethylazanium chloride (PubChem CID 158237213) has the molecular formula C19H44ClN5 and a molecular weight of 378.05 g/mol. Its IUPAC name is bis(2,2-dibutylhydrazinyl)methylidene-dimethylazanium chloride.
| Compound Name | bis(2,2-dibutylhydrazinyl)methylidene-dimethylazanium chloride |
|---|---|
| PubChem CID | 158237213 |
| Molecular Formula | C19H44ClN5 |
| Molecular Weight | 378.05 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | bis(2,2-dibutylhydrazinyl)methylidene-dimethylazanium chloride |
| SMILES | CCCCN(CCCC)NC(NN(CCCC)CCCC)=[N+](C)C.[Cl-] |
| InChI | InChI=1S/C19H43N5.ClH/c1-7-11-15-23(16-12-8-2)20-19(22(5)6)21-24(17-13-9-3)18-14-10-4;/h7-18H2,1-6H3,(H,20,21);1H |
| InChIKey | GFCLWTSGGUUVGA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 33.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.05 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|