C11H17NO2 — CID 174762674
3-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-ol (PubChem CID 174762674) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-ol.
| Compound Name | 3-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 174762674 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1C=C(O)C=CC1N1CCOCC1 |
| InChI | InChI=1S/C11H17NO2/c1-9-8-10(13)2-3-11(9)12-4-6-14-7-5-12/h2-3,8-9,11,13H,4-7H2,1H3 |
| InChIKey | IKGRRDJCLOJZEH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |