C15H18BrNO6 — CID 124631903
5-[(1S,5S)-3-bromo-5-morpholin-4-yl-2-oxocyclopent-3-en-1-yl]-6-hydroxy-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 124631903) has the molecular formula C15H18BrNO6 and a molecular weight of 388.21 g/mol. Its IUPAC name is 5-[(1S,5S)-3-bromo-5-morpholin-4-yl-2-oxocyclopent-3-en-1-yl]-6-hydroxy-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[(1S,5S)-3-bromo-5-morpholin-4-yl-2-oxocyclopent-3-en-1-yl]-6-hydroxy-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 124631903 |
| Molecular Formula | C15H18BrNO6 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 5-[(1S,5S)-3-bromo-5-morpholin-4-yl-2-oxocyclopent-3-en-1-yl]-6-hydroxy-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C([C@@H]2C(=O)C(Br)=C[C@H]2N2CCOCC2)=C(O)O1 |
| InChI | InChI=1S/C15H18BrNO6/c1-15(2)22-13(19)11(14(20)23-15)10-9(7-8(16)12(10)18)17-3-5-21-6-4-17/h7,9-10,19H,3-6H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | CHYPVLXUFSJOJX-NXEZZACHSA-N |
| XLogP | 1.24 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|