About 4-aminopyrrolidin-2-ol;hydrochloride
4-aminopyrrolidin-2-ol;hydrochloride (PubChem CID 174763411) has the molecular formula C4H11ClN2O
and a molecular weight of 138.60 g/mol. Its IUPAC name is 4-aminopyrrolidin-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-aminopyrrolidin-2-ol;hydrochloride |
| PubChem CID | 174763411 |
| Molecular Formula | C4H11ClN2O |
| Molecular Weight | 138.60 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 4-aminopyrrolidin-2-ol;hydrochloride |
| SMILES | Cl.NC1CNC(O)C1 |
| InChI | InChI=1S/C4H10N2O.ClH/c5-3-1-4(7)6-2-3;/h3-4,6-7H,1-2,5H2;1H |
| InChIKey | QFQPHUWTXODFCY-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.60 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminopyrrolidin-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyrrolidin-2-ol;hydrochloride?
The IUPAC name of 4-aminopyrrolidin-2-ol;hydrochloride (CID 174763411) is 4-aminopyrrolidin-2-ol;hydrochloride.
What is the SMILES notation for 4-aminopyrrolidin-2-ol;hydrochloride?
The canonical SMILES for 4-aminopyrrolidin-2-ol;hydrochloride is Cl.NC1CNC(O)C1.
What is the InChIKey of 4-aminopyrrolidin-2-ol;hydrochloride?
The InChIKey is QFQPHUWTXODFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O.ClH/c5-3-1-4(7)6-2-3;/h3-4,6-7H,1-2,5H2;1H.
What are the key properties of 4-aminopyrrolidin-2-ol;hydrochloride?
4-aminopyrrolidin-2-ol;hydrochloride has a molecular weight of 138.60 g/mol, XLogP of -0.95, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyrrolidin-2-ol;hydrochloride is sourced from PubChem (CID 174763411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).