C8H22N2O5S — CID 174763512
2-(dimethylamino)-2-sulfopropanoic acid;ethanamine;methane (PubChem CID 174763512) has the molecular formula C8H22N2O5S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-(dimethylamino)-2-sulfopropanoic acid;ethanamine;methane.
| Compound Name | 2-(dimethylamino)-2-sulfopropanoic acid;ethanamine;methane |
|---|---|
| PubChem CID | 174763512 |
| Molecular Formula | C8H22N2O5S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(dimethylamino)-2-sulfopropanoic acid;ethanamine;methane |
| SMILES | C.CCN.CN(C)C(C)(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C5H11NO5S.C2H7N.CH4/c1-5(4(7)8,6(2)3)12(9,10)11;1-2-3;/h1-3H3,(H,7,8)(H,9,10,11);2-3H2,1H3;1H4 |
| InChIKey | MMGOCFWZHSZZJE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|