C6H18N2O5S — CID 174763177
azane;2-(dimethylamino)-2-sulfopropanoic acid;methane (PubChem CID 174763177) has the molecular formula C6H18N2O5S and a molecular weight of 230.29 g/mol. Its IUPAC name is azane;2-(dimethylamino)-2-sulfopropanoic acid;methane.
| Compound Name | azane;2-(dimethylamino)-2-sulfopropanoic acid;methane |
|---|---|
| PubChem CID | 174763177 |
| Molecular Formula | C6H18N2O5S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | azane;2-(dimethylamino)-2-sulfopropanoic acid;methane |
| SMILES | C.CN(C)C(C)(C(=O)O)S(=O)(=O)O.N |
| InChI | InChI=1S/C5H11NO5S.CH4.H3N/c1-5(4(7)8,6(2)3)12(9,10)11;;/h1-3H3,(H,7,8)(H,9,10,11);1H4;1H3 |
| InChIKey | UBNVALJDEHQJFE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|