C7H12NNaO4S — CID 141373046
sodium 2-(dimethylamino)-3-oxopent-4-ene-2-sulfonate (PubChem CID 141373046) has the molecular formula C7H12NNaO4S and a molecular weight of 229.23 g/mol. Its IUPAC name is sodium 2-(dimethylamino)-3-oxopent-4-ene-2-sulfonate.
| Compound Name | sodium 2-(dimethylamino)-3-oxopent-4-ene-2-sulfonate |
|---|---|
| PubChem CID | 141373046 |
| Molecular Formula | C7H12NNaO4S |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | sodium 2-(dimethylamino)-3-oxopent-4-ene-2-sulfonate |
| SMILES | C=CC(=O)C(C)(N(C)C)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H13NO4S.Na/c1-5-6(9)7(2,8(3)4)13(10,11)12;/h5H,1H2,2-4H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | WELPQOFCQBNMHI-UHFFFAOYSA-M |
| XLogP | -3.43 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|