C5H12NO6S+ — CID 22056773
(carboxy-hydroxy-sulfomethyl)-trimethylazanium (PubChem CID 22056773) has the molecular formula C5H12NO6S+ and a molecular weight of 214.22 g/mol. Its IUPAC name is (carboxy-hydroxy-sulfomethyl)-trimethylazanium.
| Compound Name | (carboxy-hydroxy-sulfomethyl)-trimethylazanium |
|---|---|
| PubChem CID | 22056773 |
| Molecular Formula | C5H12NO6S+ |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (carboxy-hydroxy-sulfomethyl)-trimethylazanium |
| SMILES | C[N+](C)(C)C(O)(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C5H11NO6S/c1-6(2,3)5(9,4(7)8)13(10,11)12/h9H,1-3H3,(H-,7,8,10,11,12)/p+1 |
| InChIKey | GKXAMKYZRHBUIH-UHFFFAOYSA-O |
| XLogP | -1.69 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|