C6H13NO7S2 — CID 19904866
2-methylsulfonyl-2-sulfo-2-(trimethylazaniumyl)acetate (PubChem CID 19904866) has the molecular formula C6H13NO7S2 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-methylsulfonyl-2-sulfo-2-(trimethylazaniumyl)acetate.
| Compound Name | 2-methylsulfonyl-2-sulfo-2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 19904866 |
| Molecular Formula | C6H13NO7S2 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-methylsulfonyl-2-sulfo-2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)C(C(=O)[O-])(S(C)(=O)=O)S(=O)(=O)O |
| InChI | InChI=1S/C6H13NO7S2/c1-7(2,3)6(5(8)9,15(4,10)11)16(12,13)14/h1-4H3,(H-,8,9,12,13,14) |
| InChIKey | CJXWUCUGQJURQB-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|