C8H15NO6S — CID 89396571
2-sulfooxy-2-(trimethylazaniumyl)pent-4-enoate (PubChem CID 89396571) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-sulfooxy-2-(trimethylazaniumyl)pent-4-enoate.
| Compound Name | 2-sulfooxy-2-(trimethylazaniumyl)pent-4-enoate |
|---|---|
| PubChem CID | 89396571 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-sulfooxy-2-(trimethylazaniumyl)pent-4-enoate |
| SMILES | C=CCC(OS(=O)(=O)O)(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C8H15NO6S/c1-5-6-8(7(10)11,9(2,3)4)15-16(12,13)14/h5H,1,6H2,2-4H3,(H-,10,11,12,13,14) |
| InChIKey | BAKMEAZQEZVACH-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|