C12H24N2O8S — CID 87530480
acetic acid;2-[but-3-enyl(dimethyl)azaniumyl]-2-(dimethylaminooxy)-2-sulfoacetate (PubChem CID 87530480) has the molecular formula C12H24N2O8S and a molecular weight of 356.40 g/mol. Its IUPAC name is acetic acid;2-[but-3-enyl(dimethyl)azaniumyl]-2-(dimethylaminooxy)-2-sulfoacetate.
| Compound Name | acetic acid;2-[but-3-enyl(dimethyl)azaniumyl]-2-(dimethylaminooxy)-2-sulfoacetate |
|---|---|
| PubChem CID | 87530480 |
| Molecular Formula | C12H24N2O8S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | acetic acid;2-[but-3-enyl(dimethyl)azaniumyl]-2-(dimethylaminooxy)-2-sulfoacetate |
| SMILES | C=CCC[N+](C)(C)C(ON(C)C)(C(=O)[O-])S(=O)(=O)O.CC(=O)O |
| InChI | InChI=1S/C10H20N2O6S.C2H4O2/c1-6-7-8-12(4,5)10(9(13)14,18-11(2)3)19(15,16)17;1-2(3)4/h6H,1,7-8H2,2-5H3,(H-,13,14,15,16,17);1H3,(H,3,4) |
| InChIKey | WQOFNJQZHDYGKF-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|