C15H24Na2O7S — CID 87554354
disodium;3-(2-ethylhexyl)-2-prop-2-enyl-2-sulfobutanedioate (PubChem CID 87554354) has the molecular formula C15H24Na2O7S and a molecular weight of 394.40 g/mol. Its IUPAC name is disodium;3-(2-ethylhexyl)-2-prop-2-enyl-2-sulfobutanedioate.
| Compound Name | disodium;3-(2-ethylhexyl)-2-prop-2-enyl-2-sulfobutanedioate |
|---|---|
| PubChem CID | 87554354 |
| Molecular Formula | C15H24Na2O7S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | disodium;3-(2-ethylhexyl)-2-prop-2-enyl-2-sulfobutanedioate |
| SMILES | C=CCC(C(=O)[O-])(C(CC(CC)CCCC)C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C15H26O7S.2Na/c1-4-7-8-11(6-3)10-12(13(16)17)15(9-5-2,14(18)19)23(20,21)22;;/h5,11-12H,2,4,6-10H2,1,3H3,(H,16,17)(H,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | ROKLSJUAPAEJRT-UHFFFAOYSA-L |
| XLogP | -6.08 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|