About 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium
4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium (PubChem CID 88795386) has the molecular formula C14H30O2SSn
and a molecular weight of 381.17 g/mol. Its IUPAC name is 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium.
Molecular Properties
| Compound Name | 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium |
| PubChem CID | 88795386 |
| Molecular Formula | C14H30O2SSn |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium |
| SMILES | CCCCC(CC)CC(CS)C(=O)[O-].C[Sn+](C)C |
| InChI | InChI=1S/C11H22O2S.3CH3.Sn/c1-3-5-6-9(4-2)7-10(8-14)11(12)13;;;;/h9-10,14H,3-8H2,1-2H3,(H,12,13);3*1H3;/q;;;;+1/p-1 |
| InChIKey | BXCXZWKUJWKGIM-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium?
The IUPAC name of 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium (CID 88795386) is 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium.
What is the SMILES notation for 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium?
The canonical SMILES for 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium is CCCCC(CC)CC(CS)C(=O)[O-].C[Sn+](C)C.
What is the InChIKey of 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium?
The InChIKey is BXCXZWKUJWKGIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H22O2S.3CH3.Sn/c1-3-5-6-9(4-2)7-10(8-14)11(12)13;;;;/h9-10,14H,3-8H2,1-2H3,(H,12,13);3*1H3;/q;;;;+1/p-1.
What are the key properties of 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium?
4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium has a molecular weight of 381.17 g/mol, XLogP of 3.26, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(sulfanylmethyl)octanoate;trimethylstannanylium is sourced from PubChem (CID 88795386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).