C8H14N2Na2O7S — CID 88732906
disodium;2,3-bis(2-aminoethyl)-2-sulfobutanedioate (PubChem CID 88732906) has the molecular formula C8H14N2Na2O7S and a molecular weight of 328.25 g/mol. Its IUPAC name is disodium;2,3-bis(2-aminoethyl)-2-sulfobutanedioate.
| Compound Name | disodium;2,3-bis(2-aminoethyl)-2-sulfobutanedioate |
|---|---|
| PubChem CID | 88732906 |
| Molecular Formula | C8H14N2Na2O7S |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | disodium;2,3-bis(2-aminoethyl)-2-sulfobutanedioate |
| SMILES | NCCC(C(=O)[O-])C(CCN)(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C8H16N2O7S.2Na/c9-3-1-5(6(11)12)8(2-4-10,7(13)14)18(15,16)17;;/h5H,1-4,9-10H2,(H,11,12)(H,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | PTNKGXZBWQLYCY-UHFFFAOYSA-L |
| XLogP | -10.57 |
| TPSA | 186.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | -10.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|