C11H22NNaO5S — CID 88789387
sodium 3-(2-ethylhexylamino)-2-sulfopropanoate (PubChem CID 88789387) has the molecular formula C11H22NNaO5S and a molecular weight of 303.36 g/mol. Its IUPAC name is sodium 3-(2-ethylhexylamino)-2-sulfopropanoate.
| Compound Name | sodium 3-(2-ethylhexylamino)-2-sulfopropanoate |
|---|---|
| PubChem CID | 88789387 |
| Molecular Formula | C11H22NNaO5S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | sodium 3-(2-ethylhexylamino)-2-sulfopropanoate |
| SMILES | CCCCC(CC)CNCC(C(=O)[O-])S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C11H23NO5S.Na/c1-3-5-6-9(4-2)7-12-8-10(11(13)14)18(15,16)17;/h9-10,12H,3-8H2,1-2H3,(H,13,14)(H,15,16,17);/q;+1/p-1 |
| InChIKey | RFLQYSIRYFLBFN-UHFFFAOYSA-M |
| XLogP | -3.20 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|