C5H11NO12S4 — CID 88622078
2-[disulfomethyl(dimethyl)azaniumyl]-2,2-disulfinoacetate (PubChem CID 88622078) has the molecular formula C5H11NO12S4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[disulfomethyl(dimethyl)azaniumyl]-2,2-disulfinoacetate.
| Compound Name | 2-[disulfomethyl(dimethyl)azaniumyl]-2,2-disulfinoacetate |
|---|---|
| PubChem CID | 88622078 |
| Molecular Formula | C5H11NO12S4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 2-[disulfomethyl(dimethyl)azaniumyl]-2,2-disulfinoacetate |
| SMILES | C[N+](C)(C(S(=O)(=O)O)S(=O)(=O)O)C(C(=O)[O-])(S(=O)O)S(=O)O |
| InChI | InChI=1S/C5H11NO12S4/c1-6(2,4(21(13,14)15)22(16,17)18)5(3(7)8,19(9)10)20(11)12/h4H,1-2H3,(H4-,7,8,9,10,11,12,13,14,15,16,17,18) |
| InChIKey | CTJXACGMLOSSJI-UHFFFAOYSA-N |
| XLogP | -4.03 |
| TPSA | 223.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|