C35H47BrOP2Si — CID 174764282
phosphane;triphenyl-[[4-[tri(propan-2-yl)silyloxymethyl]phenyl]methyl]phosphanium;bromide (PubChem CID 174764282) has the molecular formula C35H47BrOP2Si and a molecular weight of 653.70 g/mol. Its IUPAC name is phosphane;triphenyl-[[4-[tri(propan-2-yl)silyloxymethyl]phenyl]methyl]phosphanium;bromide.
| Compound Name | phosphane;triphenyl-[[4-[tri(propan-2-yl)silyloxymethyl]phenyl]methyl]phosphanium;bromide |
|---|---|
| PubChem CID | 174764282 |
| Molecular Formula | C35H47BrOP2Si |
| Molecular Weight | 653.70 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | phosphane;triphenyl-[[4-[tri(propan-2-yl)silyloxymethyl]phenyl]methyl]phosphanium;bromide |
| SMILES | CC(C)[Si](OCc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)(C(C)C)C(C)C.P.[Br-] |
| InChI | InChI=1S/C35H44OPSi.BrH.H3P/c1-28(2)38(29(3)4,30(5)6)36-26-31-22-24-32(25-23-31)27-37(33-16-10-7-11-17-33,34-18-12-8-13-19-34)35-20-14-9-15-21-35;;/h7-25,28-30H,26-27H2,1-6H3;1H;1H3/q+1;;/p-1 |
| InChIKey | VMQJOQIRGPVSKY-UHFFFAOYSA-M |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|