C13H16N2O2 — CID 174764404
[1-amino-1-(3,5-dimethylphenyl)but-3-ynyl] carbamate (PubChem CID 174764404) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is [1-amino-1-(3,5-dimethylphenyl)but-3-ynyl] carbamate.
| Compound Name | [1-amino-1-(3,5-dimethylphenyl)but-3-ynyl] carbamate |
|---|---|
| PubChem CID | 174764404 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | [1-amino-1-(3,5-dimethylphenyl)but-3-ynyl] carbamate |
| SMILES | C#CCC(N)(OC(N)=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H16N2O2/c1-4-5-13(15,17-12(14)16)11-7-9(2)6-10(3)8-11/h1,6-8H,5,15H2,2-3H3,(H2,14,16) |
| InChIKey | ZZRJRCCBZOQLDT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|