C9H10F3NO2 — CID 174764945
4-methoxy-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 174764945) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 4-methoxy-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 4-methoxy-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 174764945 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-methoxy-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | COc1cc(C)nc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3NO2/c1-6-3-7(14-2)4-8(13-6)15-5-9(10,11)12/h3-4H,5H2,1-2H3 |
| InChIKey | JRIQLJUBJBWDRP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |