C22H46NNaO2 — CID 174767625
sodium;hexadecyl (2S,3S)-2-amino-3-methylpentanoate;hydride (PubChem CID 174767625) has the molecular formula C22H46NNaO2 and a molecular weight of 379.61 g/mol. Its IUPAC name is sodium;hexadecyl (2S,3S)-2-amino-3-methylpentanoate;hydride.
| Compound Name | sodium;hexadecyl (2S,3S)-2-amino-3-methylpentanoate;hydride |
|---|---|
| PubChem CID | 174767625 |
| Molecular Formula | C22H46NNaO2 |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.34 |
| IUPAC Name | sodium;hexadecyl (2S,3S)-2-amino-3-methylpentanoate;hydride |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)[C@@H](N)[C@@H](C)CC.[H-].[Na+] |
| InChI | InChI=1S/C22H45NO2.Na.H/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-22(24)21(23)20(3)5-2;;/h20-21H,4-19,23H2,1-3H3;;/q;+1;-1/t20-,21-;;/m0../s1 |
| InChIKey | ZVUIRJUXMYOQMU-HRIAXCGHSA-N |
| XLogP | 3.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|