C11H19FN2O3 — CID 174770020
[1-(2-fluoroethylcarbamoyl)cyclopropyl] N-tert-butylcarbamate (PubChem CID 174770020) has the molecular formula C11H19FN2O3 and a molecular weight of 246.28 g/mol. Its IUPAC name is [1-(2-fluoroethylcarbamoyl)cyclopropyl] N-tert-butylcarbamate.
| Compound Name | [1-(2-fluoroethylcarbamoyl)cyclopropyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174770020 |
| Molecular Formula | C11H19FN2O3 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [1-(2-fluoroethylcarbamoyl)cyclopropyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(C(=O)NCCF)CC1 |
| InChI | InChI=1S/C11H19FN2O3/c1-10(2,3)14-9(16)17-11(4-5-11)8(15)13-7-6-12/h4-7H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | XIBXPKOCYBOPEC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |