About [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride
[(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride (PubChem CID 174771032) has the molecular formula C9H22ClN2O2+
and a molecular weight of 225.74 g/mol. Its IUPAC name is [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride.
Molecular Properties
| Compound Name | [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride |
| PubChem CID | 174771032 |
| Molecular Formula | C9H22ClN2O2+ |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride |
| SMILES | C[N+](C)(C)CCCC[C@H](N)C(=O)O.Cl |
| InChI | InChI=1S/C9H20N2O2.ClH/c1-11(2,3)7-5-4-6-8(10)9(12)13;/h8H,4-7,10H2,1-3H3;1H/p+1/t8-;/m0./s1 |
| InChIKey | ZKIJKCHCMFGMCM-QRPNPIFTSA-O |
| XLogP | 0.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride?
The IUPAC name of [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride (CID 174771032) is [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride.
What is the SMILES notation for [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride?
The canonical SMILES for [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride is C[N+](C)(C)CCCC[C@H](N)C(=O)O.Cl.
What is the InChIKey of [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride?
The InChIKey is ZKIJKCHCMFGMCM-QRPNPIFTSA-O. The full InChI is InChI=1S/C9H20N2O2.ClH/c1-11(2,3)7-5-4-6-8(10)9(12)13;/h8H,4-7,10H2,1-3H3;1H/p+1/t8-;/m0./s1.
What are the key properties of [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride?
[(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride has a molecular weight of 225.74 g/mol, XLogP of 0.70, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-5-amino-5-carboxypentyl]-trimethylazanium;hydrochloride is sourced from PubChem (CID 174771032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).