About formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide
formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide (PubChem CID 174772231) has the molecular formula C9H18INO4
and a molecular weight of 331.15 g/mol. Its IUPAC name is formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide.
Molecular Properties
| Compound Name | formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide |
| PubChem CID | 174772231 |
| Molecular Formula | C9H18INO4 |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide |
| SMILES | C=CC(=O)OC=O.C[N+](C)(C)CCO.[I-] |
| InChI | InChI=1S/C5H14NO.C4H4O3.HI/c1-6(2,3)4-5-7;1-2-4(6)7-3-5;/h7H,4-5H2,1-3H3;2-3H,1H2;1H/q+1;;/p-1 |
| InChIKey | SSJZNQIVNCCXKT-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide?
The IUPAC name of formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide (CID 174772231) is formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide.
What is the SMILES notation for formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide?
The canonical SMILES for formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide is C=CC(=O)OC=O.C[N+](C)(C)CCO.[I-].
What is the InChIKey of formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide?
The InChIKey is SSJZNQIVNCCXKT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14NO.C4H4O3.HI/c1-6(2,3)4-5-7;1-2-4(6)7-3-5;/h7H,4-5H2,1-3H3;2-3H,1H2;1H/q+1;;/p-1.
What are the key properties of formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide?
formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide has a molecular weight of 331.15 g/mol, XLogP of -3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formyl prop-2-enoate;2-hydroxyethyl(trimethyl)azanium;iodide is sourced from PubChem (CID 174772231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).