C13H15F2NO3 — CID 174772549
[[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate (PubChem CID 174772549) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate.
| Compound Name | [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174772549 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NO3/c1-13(2,3)12(18)19-16-7-11(17)9-6-8(14)4-5-10(9)15/h4-6,16H,7H2,1-3H3 |
| InChIKey | JKRPJXRHTCBCTI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|