About [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate
[[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate (PubChem CID 174772549) has the molecular formula C13H15F2NO3
and a molecular weight of 271.26 g/mol. Its IUPAC name is [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate |
| PubChem CID | 174772549 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NO3/c1-13(2,3)12(18)19-16-7-11(17)9-6-8(14)4-5-10(9)15/h4-6,16H,7H2,1-3H3 |
| InChIKey | JKRPJXRHTCBCTI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate?
The IUPAC name of [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate (CID 174772549) is [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate.
What is the SMILES notation for [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate?
The canonical SMILES for [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate is CC(C)(C)C(=O)ONCC(=O)c1cc(F)ccc1F.
What is the InChIKey of [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate?
The InChIKey is JKRPJXRHTCBCTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO3/c1-13(2,3)12(18)19-16-7-11(17)9-6-8(14)4-5-10(9)15/h4-6,16H,7H2,1-3H3.
What are the key properties of [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate?
[[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate has a molecular weight of 271.26 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(2,5-difluorophenyl)-2-oxoethyl]amino] 2,2-dimethylpropanoate is sourced from PubChem (CID 174772549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).