C21H16N6O4 — CID 174775984
2,4-bis(benzotriazol-1-yl)-5-(oxiran-2-ylmethoxy)benzene-1,3-diol (PubChem CID 174775984) has the molecular formula C21H16N6O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2,4-bis(benzotriazol-1-yl)-5-(oxiran-2-ylmethoxy)benzene-1,3-diol.
| Compound Name | 2,4-bis(benzotriazol-1-yl)-5-(oxiran-2-ylmethoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 174775984 |
| Molecular Formula | C21H16N6O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2,4-bis(benzotriazol-1-yl)-5-(oxiran-2-ylmethoxy)benzene-1,3-diol |
| SMILES | Oc1cc(OCC2CO2)c(-n2nnc3ccccc32)c(O)c1-n1nnc2ccccc21 |
| InChI | InChI=1S/C21H16N6O4/c28-17-9-18(31-11-12-10-30-12)20(27-16-8-4-2-6-14(16)23-25-27)21(29)19(17)26-15-7-3-1-5-13(15)22-24-26/h1-9,12,28-29H,10-11H2 |
| InChIKey | DSTNEODDRLZUDS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|