About azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate
azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate (PubChem CID 174777651) has the molecular formula C7H22N2O5S
and a molecular weight of 246.33 g/mol. Its IUPAC name is azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate.
Molecular Properties
| Compound Name | azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate |
| PubChem CID | 174777651 |
| Molecular Formula | C7H22N2O5S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate |
| SMILES | CCC(O)OS(=O)(=O)OC.CN(C)C.N |
| InChI | InChI=1S/C4H10O5S.C3H9N.H3N/c1-3-4(5)9-10(6,7)8-2;1-4(2)3;/h4-5H,3H2,1-2H3;1-3H3;1H3 |
| InChIKey | CWDOFJVZOYWQMS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate?
The IUPAC name of azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate (CID 174777651) is azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate.
What is the SMILES notation for azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate?
The canonical SMILES for azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate is CCC(O)OS(=O)(=O)OC.CN(C)C.N.
What is the InChIKey of azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate?
The InChIKey is CWDOFJVZOYWQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O5S.C3H9N.H3N/c1-3-4(5)9-10(6,7)8-2;1-4(2)3;/h4-5H,3H2,1-2H3;1-3H3;1H3.
What are the key properties of azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate?
azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate has a molecular weight of 246.33 g/mol, XLogP of -0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N,N-dimethylmethanamine;1-hydroxypropyl methyl sulfate is sourced from PubChem (CID 174777651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).