C18H20O2 — CID 174782635
(3,6-diethyl-9H-fluoren-9-yl)methanediol (PubChem CID 174782635) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3,6-diethyl-9H-fluoren-9-yl)methanediol.
| Compound Name | (3,6-diethyl-9H-fluoren-9-yl)methanediol |
|---|---|
| PubChem CID | 174782635 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (3,6-diethyl-9H-fluoren-9-yl)methanediol |
| SMILES | CCc1ccc2c(c1)-c1cc(CC)ccc1C2C(O)O |
| InChI | InChI=1S/C18H20O2/c1-3-11-5-7-13-15(9-11)16-10-12(4-2)6-8-14(16)17(13)18(19)20/h5-10,17-20H,3-4H2,1-2H3 |
| InChIKey | UEGNYYOLMUGESN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|