C12H16Br2O2 — CID 174782644
1,2-bis(2-bromo-2-methoxyethyl)benzene (PubChem CID 174782644) has the molecular formula C12H16Br2O2 and a molecular weight of 352.07 g/mol. Its IUPAC name is 1,2-bis(2-bromo-2-methoxyethyl)benzene.
| Compound Name | 1,2-bis(2-bromo-2-methoxyethyl)benzene |
|---|---|
| PubChem CID | 174782644 |
| Molecular Formula | C12H16Br2O2 |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 1,2-bis(2-bromo-2-methoxyethyl)benzene |
| SMILES | COC(Br)Cc1ccccc1CC(Br)OC |
| InChI | InChI=1S/C12H16Br2O2/c1-15-11(13)7-9-5-3-4-6-10(9)8-12(14)16-2/h3-6,11-12H,7-8H2,1-2H3 |
| InChIKey | KSBWSGJZQLHACQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|