C21H25N5O4 — CID 174782756
2-(methoxymethyl)-9-methyl-7-[(3S)-3-(4-methylphenoxy)pyrrolidine-1-carbonyl]-8H-purine-8-carbaldehyde (PubChem CID 174782756) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(methoxymethyl)-9-methyl-7-[(3S)-3-(4-methylphenoxy)pyrrolidine-1-carbonyl]-8H-purine-8-carbaldehyde.
| Compound Name | 2-(methoxymethyl)-9-methyl-7-[(3S)-3-(4-methylphenoxy)pyrrolidine-1-carbonyl]-8H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 174782756 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-(methoxymethyl)-9-methyl-7-[(3S)-3-(4-methylphenoxy)pyrrolidine-1-carbonyl]-8H-purine-8-carbaldehyde |
| SMILES | COCc1ncc2c(n1)N(C)C(C=O)N2C(=O)N1CC[C@H](Oc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C21H25N5O4/c1-14-4-6-15(7-5-14)30-16-8-9-25(11-16)21(28)26-17-10-22-18(13-29-3)23-20(17)24(2)19(26)12-27/h4-7,10,12,16,19H,8-9,11,13H2,1-3H3/t16-,19?/m0/s1 |
| InChIKey | JLOIELWCNUCHEP-UCFFOFKASA-N |
| XLogP | 1.99 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|