C19H19F2N5O2 — CID 174782793
2-[(2,6-difluorophenyl)methyl]-9-methyl-7-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde (PubChem CID 174782793) has the molecular formula C19H19F2N5O2 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methyl]-9-methyl-7-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde.
| Compound Name | 2-[(2,6-difluorophenyl)methyl]-9-methyl-7-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 174782793 |
| Molecular Formula | C19H19F2N5O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methyl]-9-methyl-7-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde |
| SMILES | CN1c2nc(Cc3c(F)cccc3F)ncc2N(C(=O)N2CCCC2)C1C=O |
| InChI | InChI=1S/C19H19F2N5O2/c1-24-17(11-27)26(19(28)25-7-2-3-8-25)15-10-22-16(23-18(15)24)9-12-13(20)5-4-6-14(12)21/h4-6,10-11,17H,2-3,7-9H2,1H3 |
| InChIKey | RRMZEIWHPFWUKY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|