C20H20F3N5O4 — CID 175274119
2-(methoxymethyl)-9-methyl-7-[3-[4-(trifluoromethoxy)phenyl]azetidine-1-carbonyl]-8H-purine-8-carbaldehyde (PubChem CID 175274119) has the molecular formula C20H20F3N5O4 and a molecular weight of 451.41 g/mol. Its IUPAC name is 2-(methoxymethyl)-9-methyl-7-[3-[4-(trifluoromethoxy)phenyl]azetidine-1-carbonyl]-8H-purine-8-carbaldehyde.
| Compound Name | 2-(methoxymethyl)-9-methyl-7-[3-[4-(trifluoromethoxy)phenyl]azetidine-1-carbonyl]-8H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 175274119 |
| Molecular Formula | C20H20F3N5O4 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-(methoxymethyl)-9-methyl-7-[3-[4-(trifluoromethoxy)phenyl]azetidine-1-carbonyl]-8H-purine-8-carbaldehyde |
| SMILES | COCc1ncc2c(n1)N(C)C(C=O)N2C(=O)N1CC(c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H20F3N5O4/c1-26-17(10-29)28(15-7-24-16(11-31-2)25-18(15)26)19(30)27-8-13(9-27)12-3-5-14(6-4-12)32-20(21,22)23/h3-7,10,13,17H,8-9,11H2,1-2H3 |
| InChIKey | VJPFEQRHEZGKJF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|