C19H20FN5O2 — CID 175295132
2-[(3-fluorophenyl)methyl]-7-methyl-9-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde (PubChem CID 175295132) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-7-methyl-9-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde.
| Compound Name | 2-[(3-fluorophenyl)methyl]-7-methyl-9-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 175295132 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-7-methyl-9-(pyrrolidine-1-carbonyl)-8H-purine-8-carbaldehyde |
| SMILES | CN1c2cnc(Cc3cccc(F)c3)nc2N(C(=O)N2CCCC2)C1C=O |
| InChI | InChI=1S/C19H20FN5O2/c1-23-15-11-21-16(10-13-5-4-6-14(20)9-13)22-18(15)25(17(23)12-26)19(27)24-7-2-3-8-24/h4-6,9,11-12,17H,2-3,7-8,10H2,1H3 |
| InChIKey | XLCQCATUFGVBKT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|