About [bis(hydroxymethyl)amino]methanol;titanium
[bis(hydroxymethyl)amino]methanol;titanium (PubChem CID 174785911) has the molecular formula C3H9NO3Ti
and a molecular weight of 154.98 g/mol. Its IUPAC name is [bis(hydroxymethyl)amino]methanol;titanium.
Molecular Properties
| Compound Name | [bis(hydroxymethyl)amino]methanol;titanium |
| PubChem CID | 174785911 |
| Molecular Formula | C3H9NO3Ti |
| Molecular Weight | 154.98 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | [bis(hydroxymethyl)amino]methanol;titanium |
| SMILES | OCN(CO)CO.[Ti] |
| InChI | InChI=1S/C3H9NO3.Ti/c5-1-4(2-6)3-7;/h5-7H,1-3H2; |
| InChIKey | LUWBGYRMIUMSLS-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.98 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [bis(hydroxymethyl)amino]methanol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(hydroxymethyl)amino]methanol;titanium?
The IUPAC name of [bis(hydroxymethyl)amino]methanol;titanium (CID 174785911) is [bis(hydroxymethyl)amino]methanol;titanium.
What is the SMILES notation for [bis(hydroxymethyl)amino]methanol;titanium?
The canonical SMILES for [bis(hydroxymethyl)amino]methanol;titanium is OCN(CO)CO.[Ti].
What is the InChIKey of [bis(hydroxymethyl)amino]methanol;titanium?
The InChIKey is LUWBGYRMIUMSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO3.Ti/c5-1-4(2-6)3-7;/h5-7H,1-3H2;.
What are the key properties of [bis(hydroxymethyl)amino]methanol;titanium?
[bis(hydroxymethyl)amino]methanol;titanium has a molecular weight of 154.98 g/mol, XLogP of -1.86, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(hydroxymethyl)amino]methanol;titanium is sourced from PubChem (CID 174785911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).