C25H23F3N6O3 — CID 174786733
N-[4-(aminomethyl)phenyl]-6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 174786733) has the molecular formula C25H23F3N6O3 and a molecular weight of 512.49 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 174786733 |
| Molecular Formula | C25H23F3N6O3 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | COCc1nc2c(C(=O)Nc3ccc(CN)cc3)cc(N(N)C(=O)c3ccccc3C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C25H23F3N6O3/c1-37-13-21-32-20-11-16(34(30)24(36)17-4-2-3-5-19(17)25(26,27)28)10-18(22(20)33-21)23(35)31-15-8-6-14(12-29)7-9-15/h2-11H,12-13,29-30H2,1H3,(H,31,35)(H,32,33) |
| InChIKey | VXOBRDUSEUONGH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|