C27H24ClF3N6O2 — CID 174786865
6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-pyrrolidin-1-yl-1H-benzimidazole-4-carboxamide (PubChem CID 174786865) has the molecular formula C27H24ClF3N6O2 and a molecular weight of 556.98 g/mol. Its IUPAC name is 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-pyrrolidin-1-yl-1H-benzimidazole-4-carboxamide.
| Compound Name | 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-pyrrolidin-1-yl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 174786865 |
| Molecular Formula | C27H24ClF3N6O2 |
| Molecular Weight | 556.98 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-pyrrolidin-1-yl-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cc(N(N)C(=O)c2ccccc2C(F)(F)F)cc2[nH]c(N3CCCC3)nc12 |
| InChI | InChI=1S/C27H24ClF3N6O2/c1-15-20(28)9-6-10-21(15)33-24(38)18-13-16(14-22-23(18)35-26(34-22)36-11-4-5-12-36)37(32)25(39)17-7-2-3-8-19(17)27(29,30)31/h2-3,6-10,13-14H,4-5,11-12,32H2,1H3,(H,33,38)(H,34,35) |
| InChIKey | YQKGTTLAANZOIF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.98 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|