C23H17ClF3N5O2 — CID 175295610
6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(3-chloro-2-methylphenyl)-1H-benzimidazole-4-carboxamide (PubChem CID 175295610) has the molecular formula C23H17ClF3N5O2 and a molecular weight of 487.87 g/mol. Its IUPAC name is 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(3-chloro-2-methylphenyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(3-chloro-2-methylphenyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 175295610 |
| Molecular Formula | C23H17ClF3N5O2 |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-2-(3-chloro-2-methylphenyl)-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1c(Cl)cccc1-c1nc2c(C(N)=O)cc(N(N)C(=O)c3ccccc3C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C23H17ClF3N5O2/c1-11-13(6-4-8-17(11)24)21-30-18-10-12(9-15(20(28)33)19(18)31-21)32(29)22(34)14-5-2-3-7-16(14)23(25,26)27/h2-10H,29H2,1H3,(H2,28,33)(H,30,31) |
| InChIKey | JRBJNZDCJBPZIU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|