C26H25Cl2F3N6O2 — CID 174786811
6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-[(dimethylamino)methyl]-1H-benzimidazole-4-carboxamide;hydrochloride (PubChem CID 174786811) has the molecular formula C26H25Cl2F3N6O2 and a molecular weight of 581.43 g/mol. Its IUPAC name is 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-[(dimethylamino)methyl]-1H-benzimidazole-4-carboxamide;hydrochloride.
| Compound Name | 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-[(dimethylamino)methyl]-1H-benzimidazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 174786811 |
| Molecular Formula | C26H25Cl2F3N6O2 |
| Molecular Weight | 581.43 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 6-[amino-[2-(trifluoromethyl)benzoyl]amino]-N-(3-chloro-2-methylphenyl)-2-[(dimethylamino)methyl]-1H-benzimidazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cc(N(N)C(=O)c2ccccc2C(F)(F)F)cc2[nH]c(CN(C)C)nc12.Cl |
| InChI | InChI=1S/C26H24ClF3N6O2.ClH/c1-14-19(27)9-6-10-20(14)33-24(37)17-11-15(12-21-23(17)34-22(32-21)13-35(2)3)36(31)25(38)16-7-4-5-8-18(16)26(28,29)30;/h4-12H,13,31H2,1-3H3,(H,32,34)(H,33,37);1H |
| InChIKey | IKPZEDBRIYSAJN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|