About nitro prop-2-ene-1-sulfonate
nitro prop-2-ene-1-sulfonate (PubChem CID 174788650) has the molecular formula C3H5NO5S
and a molecular weight of 167.14 g/mol. Its IUPAC name is nitro prop-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | nitro prop-2-ene-1-sulfonate |
| PubChem CID | 174788650 |
| Molecular Formula | C3H5NO5S |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | nitro prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)O[N+](=O)[O-] |
| InChI | InChI=1S/C3H5NO5S/c1-2-3-10(7,8)9-4(5)6/h2H,1,3H2 |
| InChIKey | OWXJUUVDUAVUNG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro prop-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro prop-2-ene-1-sulfonate?
The IUPAC name of nitro prop-2-ene-1-sulfonate (CID 174788650) is nitro prop-2-ene-1-sulfonate.
What is the SMILES notation for nitro prop-2-ene-1-sulfonate?
The canonical SMILES for nitro prop-2-ene-1-sulfonate is C=CCS(=O)(=O)O[N+](=O)[O-].
What is the InChIKey of nitro prop-2-ene-1-sulfonate?
The InChIKey is OWXJUUVDUAVUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO5S/c1-2-3-10(7,8)9-4(5)6/h2H,1,3H2.
What are the key properties of nitro prop-2-ene-1-sulfonate?
nitro prop-2-ene-1-sulfonate has a molecular weight of 167.14 g/mol, XLogP of -0.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitro prop-2-ene-1-sulfonate is sourced from PubChem (CID 174788650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).