C7H9NO3 — CID 174789206
3,5-dihydroxy-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 174789206) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 3,5-dihydroxy-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3,5-dihydroxy-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 174789206 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 3,5-dihydroxy-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(O)c(C)c1O |
| InChI | InChI=1S/C7H9NO3/c1-3-5(9)4(2)8-7(11)6(3)10/h9-10H,1-2H3,(H,8,11) |
| InChIKey | MPTQGNIAFOKDRO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |