C23H27N2O2S- — CID 174789964
[4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]phenyl]methanesulfinate (PubChem CID 174789964) has the molecular formula C23H27N2O2S- and a molecular weight of 395.55 g/mol. Its IUPAC name is [4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]phenyl]methanesulfinate.
| Compound Name | [4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174789964 |
| Molecular Formula | C23H27N2O2S- |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]phenyl]methanesulfinate |
| SMILES | Cc1cc(C)c2[nH]ccc2c1CN1CCCCC1c1ccc(CS(=O)[O-])cc1 |
| InChI | InChI=1S/C23H28N2O2S/c1-16-13-17(2)23-20(10-11-24-23)21(16)14-25-12-4-3-5-22(25)19-8-6-18(7-9-19)15-28(26)27/h6-11,13,22,24H,3-5,12,14-15H2,1-2H3,(H,26,27)/p-1 |
| InChIKey | HRSROGMMRAXPON-UHFFFAOYSA-M |
| XLogP | 4.89 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|