C30H25NO5 — CID 174790986
4-[[benzoyl-[2-[4-(3-methoxyphenoxy)phenyl]ethenyl]amino]methyl]benzoic acid (PubChem CID 174790986) has the molecular formula C30H25NO5 and a molecular weight of 479.53 g/mol. Its IUPAC name is 4-[[benzoyl-[2-[4-(3-methoxyphenoxy)phenyl]ethenyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[benzoyl-[2-[4-(3-methoxyphenoxy)phenyl]ethenyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 174790986 |
| Molecular Formula | C30H25NO5 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[[benzoyl-[2-[4-(3-methoxyphenoxy)phenyl]ethenyl]amino]methyl]benzoic acid |
| SMILES | COc1cccc(Oc2ccc(C=CN(Cc3ccc(C(=O)O)cc3)C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H25NO5/c1-35-27-8-5-9-28(20-27)36-26-16-12-22(13-17-26)18-19-31(29(32)24-6-3-2-4-7-24)21-23-10-14-25(15-11-23)30(33)34/h2-20H,21H2,1H3,(H,33,34) |
| InChIKey | GSJAGIUFMQNMQU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |