About butanal;N,N-dibutylbutan-1-amine
butanal;N,N-dibutylbutan-1-amine (PubChem CID 174791584) has the molecular formula C16H35NO
and a molecular weight of 257.46 g/mol. Its IUPAC name is butanal;N,N-dibutylbutan-1-amine.
Molecular Properties
| Compound Name | butanal;N,N-dibutylbutan-1-amine |
| PubChem CID | 174791584 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | butanal;N,N-dibutylbutan-1-amine |
| SMILES | CCCC=O.CCCCN(CCCC)CCCC |
| InChI | InChI=1S/C12H27N.C4H8O/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-3-4-5/h4-12H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | JNTKDUADDUPLAU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butanal;N,N-dibutylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanal;N,N-dibutylbutan-1-amine?
The IUPAC name of butanal;N,N-dibutylbutan-1-amine (CID 174791584) is butanal;N,N-dibutylbutan-1-amine.
What is the SMILES notation for butanal;N,N-dibutylbutan-1-amine?
The canonical SMILES for butanal;N,N-dibutylbutan-1-amine is CCCC=O.CCCCN(CCCC)CCCC.
What is the InChIKey of butanal;N,N-dibutylbutan-1-amine?
The InChIKey is JNTKDUADDUPLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.C4H8O/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-3-4-5/h4-12H2,1-3H3;4H,2-3H2,1H3.
What are the key properties of butanal;N,N-dibutylbutan-1-amine?
butanal;N,N-dibutylbutan-1-amine has a molecular weight of 257.46 g/mol, XLogP of 4.67, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanal;N,N-dibutylbutan-1-amine is sourced from PubChem (CID 174791584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).